|
|
import sys |
|
|
import os |
|
|
sys.path.append('/home/st512/peptune/scripts/peptide-mdlm-mcts') |
|
|
import xgboost as xgb |
|
|
import torch |
|
|
import numpy as np |
|
|
from transformers import AutoModelForMaskedLM |
|
|
from tokenizer.my_tokenizers import SMILES_SPE_Tokenizer |
|
|
import warnings |
|
|
import numpy as np |
|
|
from rdkit.Chem import Descriptors, rdMolDescriptors |
|
|
from rdkit import Chem, rdBase, DataStructs |
|
|
from rdkit.Chem import AllChem |
|
|
from typing import List |
|
|
from scoring.functions.transformation import TransformFunction |
|
|
from transformers import AutoModelForMaskedLM |
|
|
|
|
|
|
|
|
rdBase.DisableLog('rdApp.error') |
|
|
warnings.filterwarnings("ignore", category=DeprecationWarning) |
|
|
warnings.filterwarnings("ignore", category=UserWarning) |
|
|
warnings.filterwarnings("ignore", category=FutureWarning) |
|
|
|
|
|
def fingerprints_from_smiles(smiles: List, size=2048): |
|
|
""" Create ECFP fingerprints of smiles, with validity check """ |
|
|
fps = [] |
|
|
valid_mask = [] |
|
|
for i, smile in enumerate(smiles): |
|
|
mol = Chem.MolFromSmiles(smile) |
|
|
valid_mask.append(int(mol is not None)) |
|
|
fp = fingerprints_from_mol(mol, size=size) if mol else np.zeros((1, size)) |
|
|
fps.append(fp) |
|
|
|
|
|
fps = np.concatenate(fps, axis=0) |
|
|
return fps, valid_mask |
|
|
|
|
|
|
|
|
def fingerprints_from_mol(molecule, radius=3, size=2048, hashed=False): |
|
|
""" Create ECFP fingerprint of a molecule """ |
|
|
if hashed: |
|
|
fp_bits = AllChem.GetHashedMorganFingerprint(molecule, radius, nBits=size) |
|
|
else: |
|
|
fp_bits = AllChem.GetMorganFingerprintAsBitVect(molecule, radius, nBits=size) |
|
|
fp_np = np.zeros((1,)) |
|
|
DataStructs.ConvertToNumpyArray(fp_bits, fp_np) |
|
|
return fp_np.reshape(1, -1) |
|
|
|
|
|
def getMolDescriptors(mol, missingVal=0): |
|
|
""" calculate the full list of descriptors for a molecule """ |
|
|
|
|
|
values, names = [], [] |
|
|
for nm, fn in Descriptors._descList: |
|
|
try: |
|
|
val = fn(mol) |
|
|
except: |
|
|
val = missingVal |
|
|
values.append(val) |
|
|
names.append(nm) |
|
|
|
|
|
custom_descriptors = {'hydrogen-bond donors': rdMolDescriptors.CalcNumLipinskiHBD, |
|
|
'hydrogen-bond acceptors': rdMolDescriptors.CalcNumLipinskiHBA, |
|
|
'rotatable bonds': rdMolDescriptors.CalcNumRotatableBonds,} |
|
|
|
|
|
for nm, fn in custom_descriptors.items(): |
|
|
try: |
|
|
val = fn(mol) |
|
|
except: |
|
|
val = missingVal |
|
|
values.append(val) |
|
|
names.append(nm) |
|
|
return values, names |
|
|
|
|
|
def get_pep_dps_from_smi(smi): |
|
|
try: |
|
|
mol = Chem.MolFromSmiles(smi) |
|
|
except: |
|
|
print(f"convert smi {smi} to molecule failed!") |
|
|
mol = None |
|
|
|
|
|
dps, _ = getMolDescriptors(mol) |
|
|
return np.array(dps) |
|
|
|
|
|
|
|
|
def get_pep_dps(smi_list): |
|
|
if len(smi_list) == 0: |
|
|
return np.zeros((0, 213)) |
|
|
return np.array([get_pep_dps_from_smi(smi) for smi in smi_list]) |
|
|
|
|
|
def check_smi_validity(smiles: list): |
|
|
valid_smi, valid_idx = [], [] |
|
|
for idx, smi in enumerate(smiles): |
|
|
try: |
|
|
mol = Chem.MolFromSmiles(smi) if smi else None |
|
|
if mol: |
|
|
valid_smi.append(smi) |
|
|
valid_idx.append(idx) |
|
|
except Exception as e: |
|
|
|
|
|
pass |
|
|
return valid_smi, valid_idx |
|
|
|
|
|
class Permeability: |
|
|
|
|
|
def __init__(self): |
|
|
self.predictor = xgb.Booster(model_file='/home/st512/peptune/scripts/peptide-mdlm-mcts/scoring/functions/permeability/30K-train/best_model.json') |
|
|
self.emb_model = AutoModelForMaskedLM.from_pretrained('aaronfeller/PeptideCLM-23M-all').roformer |
|
|
self.tokenizer = SMILES_SPE_Tokenizer('/home/st512/peptune/scripts/peptide-mdlm-mcts/tokenizer/new_vocab.txt', '/home/st512/peptune/scripts/peptide-mdlm-mcts/tokenizer/new_splits.txt') |
|
|
|
|
|
def generate_embeddings(self, sequences): |
|
|
embeddings = [] |
|
|
for sequence in sequences: |
|
|
tokenized = self.tokenizer(sequence, return_tensors='pt') |
|
|
with torch.no_grad(): |
|
|
output = self.emb_model(**tokenized) |
|
|
|
|
|
embedding = output.last_hidden_state.mean(dim=1).squeeze(0).cpu().numpy() |
|
|
embeddings.append(embedding) |
|
|
return np.array(embeddings) |
|
|
|
|
|
def get_features(self, input_seqs: list, dps=False, fps=False): |
|
|
|
|
|
|
|
|
|
|
|
if fps: |
|
|
fingerprints = fingerprints_from_smiles(input_seqs)[0] |
|
|
else: |
|
|
fingerprints = torch.empty((len(input_seqs), 0)) |
|
|
|
|
|
if dps: |
|
|
descriptors = get_pep_dps(input_seqs) |
|
|
else: |
|
|
descriptors = torch.empty((len(input_seqs), 0)) |
|
|
|
|
|
embeddings = self.generate_embeddings(input_seqs) |
|
|
|
|
|
|
|
|
features = np.concatenate([fingerprints, descriptors, embeddings], axis=1) |
|
|
|
|
|
return features |
|
|
|
|
|
def get_scores(self, input_seqs: list): |
|
|
scores = -10 * np.ones(len(input_seqs)) |
|
|
features = self.get_features(input_seqs) |
|
|
|
|
|
if len(features) == 0: |
|
|
return scores |
|
|
|
|
|
features = np.nan_to_num(features, nan=0.) |
|
|
features = np.clip(features, np.finfo(np.float32).min, np.finfo(np.float32).max) |
|
|
|
|
|
features = xgb.DMatrix(features) |
|
|
|
|
|
scores = self.predictor.predict(features) |
|
|
return scores |
|
|
|
|
|
def __call__(self, input_seqs: list): |
|
|
scores = self.get_scores(input_seqs) |
|
|
return scores |
|
|
|
|
|
def unittest(): |
|
|
permeability = Permeability() |
|
|
seq = ['N[C@@H](CCCNC(=N)N)C(=O)N[C@@H](Cc1cNc2c1cc(O)cc2)C(=O)N[C@@H](CC1=CN=C-N1)C(=O)N[C@@H](CCCNC(=N)N)C(=O)N[C@@H](Cc1ccccc1)C(=O)N[C@@H](CCC(=O)O)C(=O)N[C@@H]([C@@H](O)C(C)C)C(=O)N[C@@H](Cc1ccc(O)cc1)C(=O)N[C@H](CC(=CN2)C1=C2C=CC=C1)C(=O)O'] |
|
|
scores = permeability(input_seqs=seq) |
|
|
print(scores) |
|
|
|
|
|
|
|
|
if __name__ == '__main__': |
|
|
unittest() |