File size: 5,965 Bytes
e54915d |
1 2 3 4 5 6 7 8 9 10 11 12 13 14 15 16 17 18 19 20 21 22 23 24 25 26 27 28 29 30 31 32 33 34 35 36 37 38 39 40 41 42 43 44 45 46 47 48 49 50 51 52 53 54 55 56 57 58 59 60 61 62 63 64 65 66 67 68 69 70 71 72 73 74 75 76 77 78 79 80 81 82 83 84 85 86 87 88 89 90 91 92 93 94 95 96 97 98 99 100 101 102 103 104 105 106 107 108 109 110 111 112 113 114 115 116 117 118 119 120 121 122 123 124 125 126 127 128 129 130 131 132 133 134 135 136 137 138 139 140 141 142 143 144 145 146 147 148 149 150 151 152 153 154 155 156 157 158 159 160 161 162 163 164 165 166 167 168 |
import sys
import os
sys.path.append('/home/st512/peptune/scripts/peptide-mdlm-mcts')
import xgboost as xgb
import torch
import numpy as np
from transformers import AutoModelForMaskedLM
from tokenizer.my_tokenizers import SMILES_SPE_Tokenizer
import warnings
import numpy as np
from rdkit.Chem import Descriptors, rdMolDescriptors
from rdkit import Chem, rdBase, DataStructs
from rdkit.Chem import AllChem
from typing import List
from scoring.functions.transformation import TransformFunction
from transformers import AutoModelForMaskedLM
rdBase.DisableLog('rdApp.error')
warnings.filterwarnings("ignore", category=DeprecationWarning)
warnings.filterwarnings("ignore", category=UserWarning)
warnings.filterwarnings("ignore", category=FutureWarning)
def fingerprints_from_smiles(smiles: List, size=2048):
""" Create ECFP fingerprints of smiles, with validity check """
fps = []
valid_mask = []
for i, smile in enumerate(smiles):
mol = Chem.MolFromSmiles(smile)
valid_mask.append(int(mol is not None))
fp = fingerprints_from_mol(mol, size=size) if mol else np.zeros((1, size))
fps.append(fp)
fps = np.concatenate(fps, axis=0)
return fps, valid_mask
def fingerprints_from_mol(molecule, radius=3, size=2048, hashed=False):
""" Create ECFP fingerprint of a molecule """
if hashed:
fp_bits = AllChem.GetHashedMorganFingerprint(molecule, radius, nBits=size)
else:
fp_bits = AllChem.GetMorganFingerprintAsBitVect(molecule, radius, nBits=size)
fp_np = np.zeros((1,))
DataStructs.ConvertToNumpyArray(fp_bits, fp_np)
return fp_np.reshape(1, -1)
def getMolDescriptors(mol, missingVal=0):
""" calculate the full list of descriptors for a molecule """
values, names = [], []
for nm, fn in Descriptors._descList:
try:
val = fn(mol)
except:
val = missingVal
values.append(val)
names.append(nm)
custom_descriptors = {'hydrogen-bond donors': rdMolDescriptors.CalcNumLipinskiHBD,
'hydrogen-bond acceptors': rdMolDescriptors.CalcNumLipinskiHBA,
'rotatable bonds': rdMolDescriptors.CalcNumRotatableBonds,}
for nm, fn in custom_descriptors.items():
try:
val = fn(mol)
except:
val = missingVal
values.append(val)
names.append(nm)
return values, names
def get_pep_dps_from_smi(smi):
try:
mol = Chem.MolFromSmiles(smi)
except:
print(f"convert smi {smi} to molecule failed!")
mol = None
dps, _ = getMolDescriptors(mol)
return np.array(dps)
def get_pep_dps(smi_list):
if len(smi_list) == 0:
return np.zeros((0, 213))
return np.array([get_pep_dps_from_smi(smi) for smi in smi_list])
def check_smi_validity(smiles: list):
valid_smi, valid_idx = [], []
for idx, smi in enumerate(smiles):
try:
mol = Chem.MolFromSmiles(smi) if smi else None
if mol:
valid_smi.append(smi)
valid_idx.append(idx)
except Exception as e:
# logger.debug(f'Error: {e} in smiles {smi}')
pass
return valid_smi, valid_idx
class Permeability:
def __init__(self):
self.predictor = xgb.Booster(model_file='/home/st512/peptune/scripts/peptide-mdlm-mcts/scoring/functions/permeability/30K-train/best_model.json')
self.emb_model = AutoModelForMaskedLM.from_pretrained('aaronfeller/PeptideCLM-23M-all').roformer
self.tokenizer = SMILES_SPE_Tokenizer('/home/st512/peptune/scripts/peptide-mdlm-mcts/tokenizer/new_vocab.txt', '/home/st512/peptune/scripts/peptide-mdlm-mcts/tokenizer/new_splits.txt')
def generate_embeddings(self, sequences):
embeddings = []
for sequence in sequences:
tokenized = self.tokenizer(sequence, return_tensors='pt')
with torch.no_grad():
output = self.emb_model(**tokenized)
# Mean pooling across sequence length
embedding = output.last_hidden_state.mean(dim=1).squeeze(0).cpu().numpy()
embeddings.append(embedding)
return np.array(embeddings)
def get_features(self, input_seqs: list, dps=False, fps=False):
#valid_smiles, valid_idxes = check_smi_validity(input_seqs)
if fps:
fingerprints = fingerprints_from_smiles(input_seqs)[0]
else:
fingerprints = torch.empty((len(input_seqs), 0))
if dps:
descriptors = get_pep_dps(input_seqs)
else:
descriptors = torch.empty((len(input_seqs), 0))
embeddings = self.generate_embeddings(input_seqs)
# logger.debug(f'X_fps.shape: {X_fps.shape}, X_dps.shape: {X_dps.shape}')
features = np.concatenate([fingerprints, descriptors, embeddings], axis=1)
return features
def get_scores(self, input_seqs: list):
scores = -10 * np.ones(len(input_seqs))
features = self.get_features(input_seqs)
if len(features) == 0:
return scores
features = np.nan_to_num(features, nan=0.)
features = np.clip(features, np.finfo(np.float32).min, np.finfo(np.float32).max)
features = xgb.DMatrix(features)
scores = self.predictor.predict(features)
return scores
def __call__(self, input_seqs: list):
scores = self.get_scores(input_seqs)
return scores
def unittest():
permeability = Permeability()
seq = ['N[C@@H](CCCNC(=N)N)C(=O)N[C@@H](Cc1cNc2c1cc(O)cc2)C(=O)N[C@@H](CC1=CN=C-N1)C(=O)N[C@@H](CCCNC(=N)N)C(=O)N[C@@H](Cc1ccccc1)C(=O)N[C@@H](CCC(=O)O)C(=O)N[C@@H]([C@@H](O)C(C)C)C(=O)N[C@@H](Cc1ccc(O)cc1)C(=O)N[C@H](CC(=CN2)C1=C2C=CC=C1)C(=O)O']
scores = permeability(input_seqs=seq)
print(scores)
if __name__ == '__main__':
unittest() |